EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35NO3 |
| Net Charge | 0 |
| Average Mass | 385.548 |
| Monoisotopic Mass | 385.26169 |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)NCC(=O)O |
| InChI | InChI=1S/C24H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(26)25-22-24(27)28/h10-21H,2-9,22H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | KXBXJDAVBNHVKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Docosahexaenoylglycine (CHEBI:184045) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-(docosa-2,4,6,8,10,12-hexaenoylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 26542107 | ChemSpider |