EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H37NO2 |
| Net Charge | 0 |
| Average Mass | 287.488 |
| Monoisotopic Mass | 287.28243 |
| SMILES | CCCCCCCCCCCCCCC(O)C(N)CO |
| InChI | InChI=1S/C17H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(20)16(18)15-19/h16-17,19-20H,2-15,18H2,1H3 |
| InChIKey | KFQUQCFJDMSIJF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C17-sphinganine (CHEBI:184033) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| 2-aminoheptadecane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 57507665 | ChemSpider |