EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N3O2 |
| Net Charge | 0 |
| Average Mass | 391.515 |
| Monoisotopic Mass | 391.22598 |
| SMILES | CC(C)(C)OC(=O)c1ccc(CN2CCN(c3cccc4nccc34)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-24(2,3)29-23(28)19-9-7-18(8-10-19)17-26-13-15-27(16-14-26)22-6-4-5-21-20(22)11-12-25-21/h4-12,25H,13-17H2,1-3H3 |
| InChIKey | WVPYSZULKPMZLZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzoic acid, 4-[[4-(1h-indol-4-yl)-1-piperazinyl]methyl]-, 1,1-dimethylethyl ester (CHEBI:184027) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| tert-butyl 4-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]benzoate |
| Manual Xrefs | Databases |
|---|---|
| 21467566 | ChemSpider |