EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N |
| Net Charge | 0 |
| Average Mass | 163.264 |
| Monoisotopic Mass | 163.13610 |
| SMILES | CCC(Cc1ccccc1)NC |
| InChI | InChI=1S/C11H17N/c1-3-11(12-2)9-10-7-5-4-6-8-10/h4-8,11-12H,3,9H2,1-2H3 |
| InChIKey | ONNVUALDGIKEIJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylamino-1-phenylbutane (CHEBI:183993) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-methyl-1-phenylbutan-2-amine |
| Manual Xrefs | Databases |
|---|---|
| 479992 | ChemSpider |