EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO7 |
| Net Charge | 0 |
| Average Mass | 489.609 |
| Monoisotopic Mass | 489.27265 |
| SMILES | COC(/C=C/CC/C=C/C(=O)O)C(O)C(C)/C=C(C)/C=C(\C)C(=O)CCCC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C27H39NO7/c1-18(14-19(2)22(29)11-9-10-21-16-24(30)28-25(31)17-21)15-20(3)27(34)23(35-4)12-7-5-6-8-13-26(32)33/h7-8,12-15,20-21,23,27,34H,5-6,9-11,16-17H2,1-4H3,(H,32,33)(H,28,30,31)/b12-7+,13-8+,18-15+,19-14+ |
| InChIKey | SLGMSTJSVRGVPB-BESLVFPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E,11E,13E)-18-(2,6-dioxopiperidin-4-yl)-9-hydroxy-8-methoxy-10,12,14-trimethyl-15-oxooctadeca-2,6,11,13-tetraenoic acid (CHEBI:183989) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| (2E,6E,11E,13E)-18-(2,6-dioxopiperidin-4-yl)-9-hydroxy-8-methoxy-10,12,14-trimethyl-15-oxooctadeca-2,6,11,13-tetraenoic acid (CHEBI:183989) is a methyl-branched fatty acid (CHEBI:62499) |
| (2E,6E,11E,13E)-18-(2,6-dioxopiperidin-4-yl)-9-hydroxy-8-methoxy-10,12,14-trimethyl-15-oxooctadeca-2,6,11,13-tetraenoic acid (CHEBI:183989) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| (2E,6E,11E,13E)-18-(2,6-dioxopiperidin-4-yl)-9-hydroxy-8-methoxy-10,12,14-trimethyl-15-oxooctadeca-2,6,11,13-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 22912746 | ChemSpider |