EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O3 |
| Net Charge | 0 |
| Average Mass | 324.505 |
| Monoisotopic Mass | 324.26645 |
| SMILES | CCCCCC1OC1CCCCCCC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H36O3/c1-2-3-12-15-18-19(23-18)16-13-10-8-6-4-5-7-9-11-14-17-20(21)22/h7,9,18-19H,2-6,8,10-17H2,1H3,(H,21,22)/b9-7- |
| InChIKey | KZTLOTWHEAHQAZ-CLFYSBASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14,15-epoxyeicosa-5(z)-enoic acid (CHEBI:183970) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (Z)-13-(3-pentyloxiran-2-yl)tridec-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21467494 | ChemSpider |