EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N3O6S |
| Net Charge | 0 |
| Average Mass | 335.382 |
| Monoisotopic Mass | 335.11511 |
| SMILES | CCSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H21N3O6S/c1-2-22-6-8(11(19)14-5-10(17)18)15-9(16)4-3-7(13)12(20)21/h7-8H,2-6,13H2,1H3,(H,14,19)(H,15,16)(H,17,18)(H,20,21)/t7-,8-/m0/s1 |
| InChIKey | HMFDVPSBWOHOAP-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glutathione ethyl ester (CHEBI:183921) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-ethylsulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 96831 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:24425-52-3 | ChemIDplus |