EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N2O4 |
| Net Charge | 0 |
| Average Mass | 402.535 |
| Monoisotopic Mass | 402.25186 |
| SMILES | [H][C@@]12CC[C@@]3([H])NC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](C(=O)NC(C)(C)C(=O)O)CC[C@@]21[H] |
| InChI | InChI=1S/C23H34N2O4/c1-21(2,20(28)29)25-19(27)16-7-6-14-13-5-8-17-23(4,12-10-18(26)24-17)15(13)9-11-22(14,16)3/h10,12-17H,5-9,11H2,1-4H3,(H,24,26)(H,25,27)(H,28,29)/t13-,14-,15-,16+,17+,22-,23+/m0/s1 |
| InChIKey | OFTBMAPJHKDDJV-MKMSXTRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Finasteride Carboxylic Acid (CHEBI:183916) has role androgen (CHEBI:50113) |
| Finasteride Carboxylic Acid (CHEBI:183916) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| 2-[[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-]quinoline-1-carbonyl]amino]-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 18612025 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:116285-37-1 | ChemIDplus |