EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29NO2S |
| Net Charge | 0 |
| Average Mass | 287.469 |
| Monoisotopic Mass | 287.19190 |
| SMILES | CCCCCCCCCCCC1N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C15H29NO2S/c1-2-3-4-5-6-7-8-9-10-11-14-16-13(12-19-14)15(17)18/h13-14,16H,2-12H2,1H3,(H,17,18)/t13-,14?/m0/s1 |
| InChIKey | FNBSOIBCKUUVJJ-LSLKUGRBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-thiazolidinecarboxylic acid, 2-undecyl-, (4r)- (CHEBI:183890) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (4R)-2-undecyl-1,3-thiazolidine-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2009694 | ChemSpider |