EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N2O5 |
| Net Charge | 0 |
| Average Mass | 468.594 |
| Monoisotopic Mass | 468.26242 |
| SMILES | CCOc1cc(CC(=O)NC(CC(C)C)c2ccccc2N2CCCC(O)C2)ccc1C(=O)O |
| InChI | InChI=1S/C27H36N2O5/c1-4-34-25-15-19(11-12-22(25)27(32)33)16-26(31)28-23(14-18(2)3)21-9-5-6-10-24(21)29-13-7-8-20(30)17-29/h5-6,9-12,15,18,20,23,30H,4,7-8,13-14,16-17H2,1-3H3,(H,28,31)(H,32,33) |
| InChIKey | OBMAZJVHPAVADF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-Hydroxy Repaglinide(Mixture of Diastereomers) (CHEBI:183883) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 2-ethoxy-4-[2-[[1-[2-(3-hydroxypiperidin-1-yl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 22547080 | ChemSpider |
| HMDB0060979 | HMDB |