EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO4S |
| Net Charge | 0 |
| Average Mass | 237.321 |
| Monoisotopic Mass | 237.10348 |
| SMILES | O=S(=O)(O)CC(O)CNC1CCCCC1 |
| InChI | InChI=1S/C9H19NO4S/c11-9(7-15(12,13)14)6-10-8-4-2-1-3-5-8/h8-11H,1-7H2,(H,12,13,14) |
| InChIKey | INEWUCPYEUEQTN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(cyclohexylamino)-2-hydroxy-1-propanesulfonic acid (CHEBI:183882) is a amine (CHEBI:32952) |
| IUPAC Name |
|---|
| 3-(cyclohexylamino)-2-hydroxypropane-1-sulonic acid |
| Manual Xrefs | Databases |
|---|---|
| 2015277 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:73463-39-5 | ChemIDplus |