EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O12 |
| Net Charge | 0 |
| Average Mass | 484.454 |
| Monoisotopic Mass | 484.15808 |
| SMILES | CC(CO[C@@H]1O[C@H](COC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O)C1(O)COC(=O)C1 |
| InChI | InChI=1S/C22H28O12/c1-11(22(30)7-17(26)33-10-22)8-32-21-20(29)19(28)18(27)15(34-21)9-31-16(25)5-3-12-2-4-13(23)14(24)6-12/h2-6,11,15,18-21,23-24,27-30H,7-10H2,1H3/b5-3+/t11?,15-,18-,19+,20-,21-,22?/m1/s1 |
| InChIKey | YNPOIPFNQJKGQJ-SALKWGHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(2r,3s,4s,5r,6r)-3,4,5-trihydroxy-6-[2-(3-hydroxy-5-oxooxolan-3-yl)propoxy]oxan-2-yl]methyl (e)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CHEBI:183876) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-(3-hydroxy-5-oxooxolan-3-yl)propoxy]oxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 22913948 | ChemSpider |