EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4 |
| Net Charge | 0 |
| Average Mass | 237.255 |
| Monoisotopic Mass | 237.10011 |
| SMILES | CCOc1cc(NC(C)=O)ccc1C(=O)OC |
| InChI | InChI=1S/C12H15NO4/c1-4-17-11-7-9(13-8(2)14)5-6-10(11)12(15)16-3/h5-7H,4H2,1-3H3,(H,13,14) |
| InChIKey | GOVWOKSKFSBNGD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3487) | Strain: C57BL [EFO:0005181] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethopabate (CHEBI:183844) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| methyl 4-acetamido-2-ethoxybenzoate |