EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO9S2 |
| Net Charge | 0 |
| Average Mass | 423.465 |
| Monoisotopic Mass | 423.06577 |
| SMILES | O=S(=O)(O)O/N=C(\CCc1ccccc1)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H21NO9S2/c17-8-10-12(18)13(19)14(20)15(24-10)26-11(16-25-27(21,22)23)7-6-9-4-2-1-3-5-9/h1-5,10,12-15,17-20H,6-8H2,(H,21,22,23)/b16-11+ |
| InChIKey | CKIJIGYDFNXSET-LFIBNONCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3487) | Strain: C57BL [EFO:0005181] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenethyl glucosinolate (CHEBI:183832) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-3-phenyl-N-sulooxypropanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 35014579 | ChemSpider |
| HMDB0038423 | HMDB |