EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O4 |
| Net Charge | 0 |
| Average Mass | 304.346 |
| Monoisotopic Mass | 304.14231 |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(14(19)20)8-10-9-17-12-7-5-4-6-11(10)12/h4-7,9,13,17H,8H2,1-3H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | NFVNYBJCJGKVQK-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3487) | Strain: C57BL [EFO:0005181] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(Tert-butoxy)carbonyl]-L-tryptophan (CHEBI:183830) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 75036 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13139-14-5 | ChemIDplus |