EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H53NO8 |
| Net Charge | 0 |
| Average Mass | 639.830 |
| Monoisotopic Mass | 639.37712 |
| SMILES | [H][C@@]12C[C@@]([H])(C/C=C(\C)C[C@@H](C)/C=C/C=C3\CO[C@]4([H])[C@H](O)C(C)=C[C@@]([H])(C(=O)O1)[C@]34O)O[C@@]1(C/C(=N\OC)[C@H](C)[C@@H](/C(C)=C/C(C)C)O1)C2 |
| InChI | InChI=1S/C37H53NO8/c1-21(2)14-25(6)33-26(7)31(38-42-8)19-36(46-33)18-29-17-28(45-36)13-12-23(4)15-22(3)10-9-11-27-20-43-34-32(39)24(5)16-30(35(40)44-29)37(27,34)41/h9-12,14,16,21-22,26,28-30,32-34,39,41H,13,15,17-20H2,1-8H3/b10-9+,23-12+,25-14+,27-11+,38-31+/t22-,26-,28+,29-,30-,32+,33+,34+,36-,37+/m0/s1 |
| InChIKey | YZBLFMPOMVTDJY-LSGXYNIPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3487) | Strain: C57BL [EFO:0005181] |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Moxidectin (CHEBI:183811) has role anthelminthic drug (CHEBI:35443) |
| Moxidectin (CHEBI:183811) has role antiinfective agent (CHEBI:35441) |
| Moxidectin (CHEBI:183811) is a milbemycin (CHEBI:50345) |
| IUPAC Name |
|---|
| (1R,4S,4'E,5'S,6R,6'S,8R,10E,13R,14E,16E,20R,21R,24S)-21,24-dihydroxy-4'-methoxyimino-5',11,13,22-tetramethyl-6'-[(E)-4-methylpent-2-en-2-yl]spiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
| INNs | Source |
|---|---|
| moxidectina | WHO MedNet |
| moxidectine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CL 301,423 | ChEMBL |
| CL-301,423 | ChEMBL |
| CL-301423 | ChEMBL |
| Moxidectin | ChEMBL |
| Moxidectin for veterinary use | ChEMBL |
| NSC-760424 | ChEMBL |
| Brand Name | Source |
|---|---|
| Moxidectin component of advocate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:113507-06-5 | ChemIDplus |
| Citations |
|---|