EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])C(=O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C19H26O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-14,17,20H,3-9H2,1-2H3/t12-,13-,14-,17-,18-,19-/m0/s1 |
| InChIKey | KPRGOTLNGIBVFL-GINZOMEDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (17298836) |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. prohormone Any intra-glandular substance that acts as a precursor of a hormone, usually having minimal hormonal effect itself. Prohormones generally help in amplifying the effect of existing hormones. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has functional parent dehydroepiandrosterone (CHEBI:28689) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has role human blood serum metabolite (CHEBI:85234) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has role nutraceutical (CHEBI:50733) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has role prohormone (CHEBI:71212) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a 17-oxo steroid (CHEBI:19168) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a 7-oxo steroid (CHEBI:47789) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β-hydroxyandrost-5-ene-7,17-dione |
| Synonyms | Source |
|---|---|
| 7-oxodehydroepiandrosterone | ChemIDplus |
| 7-oxo-DHEA | ChemIDplus |
| 7-keto-DHEA | ChemIDplus |
| 5-androsten-3β-ol-7,17-dione | ChEBI |
| 3β-hydroxy-5-androstene-7,17-dione | ChEBI |
| 7-oxo-dehydroepiandrosterone | ChEBI |
| Brand Name | Source |
|---|---|
| 7-Keto | ChEBI |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-5-androstene-7,17-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7-Keto-DHEA | Wikipedia |
| 167751 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:566-19-8 | ChemIDplus |
| Citations |
|---|