EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])C(=O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C19H26O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-14,17,20H,3-9H2,1-2H3/t12-,13-,14-,17-,18-,19-/m0/s1 |
| InChIKey | KPRGOTLNGIBVFL-GINZOMEDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (17298836) |
| Roles Classification |
|---|
| Biological Roles: | prohormone Any intra-glandular substance that acts as a precursor of a hormone, usually having minimal hormonal effect itself. Prohormones generally help in amplifying the effect of existing hormones. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has functional parent dehydroepiandrosterone (CHEBI:28689) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has role human blood serum metabolite (CHEBI:85234) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has role nutraceutical (CHEBI:50733) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) has role prohormone (CHEBI:71212) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a 17-oxo steroid (CHEBI:19168) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a 7-oxo steroid (CHEBI:47789) |
| 7-ketodehydroepiandrosterone (CHEBI:183808) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β-hydroxyandrost-5-ene-7,17-dione |
| Synonyms | Source |
|---|---|
| 3β-hydroxy-5-androstene-7,17-dione | ChEBI |
| 5-androsten-3β-ol-7,17-dione | ChEBI |
| 7-keto-dehydroepiandrosterone | ChEBI |
| 7-keto-DHEA | ChemIDplus |
| 7-ketoprasterone | ChEBI |
| 7-oxo-dehydroepiandrosterone | ChEBI |
| Brand Name | Source |
|---|---|
| 7-Keto | ChEBI |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-5-androstene-7,17-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 167751 | ChemSpider |
| 7-Keto-DHEA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:566-19-8 | ChemIDplus |
| Citations |
|---|