EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N4O3 |
| Net Charge | 0 |
| Average Mass | 290.323 |
| Monoisotopic Mass | 290.13789 |
| SMILES | O=C(NCc1cccnc1)C(=O)NC1CCCCNC1=O |
| InChI | InChI=1S/C14H18N4O3/c19-12-11(5-1-2-7-16-12)18-14(21)13(20)17-9-10-4-3-6-15-8-10/h3-4,6,8,11H,1-2,5,7,9H2,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | CRRGKIISXWJPNP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1-(2-oxoazepan-3-yl)-N2-(3-pyridylmethyl)ethanediamide (CHEBI:183787) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N'-(2-oxoazepan-3-yl)-N-(pyridin-3-ylmethyl)oxamide |
| Manual Xrefs | Databases |
|---|---|
| 2084215 | ChemSpider |