EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N2O2 |
| Net Charge | 0 |
| Average Mass | 378.516 |
| Monoisotopic Mass | 378.23073 |
| SMILES | O=C(C1CCCO1)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c27-24(23-12-7-19-28-23)26(21-10-5-2-6-11-21)22-14-17-25(18-15-22)16-13-20-8-3-1-4-9-20/h1-6,8-11,22-23H,7,12-19H2 |
| InChIKey | OHJNHKUFSKAANI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrofuranylfentanyl (CHEBI:183782) has role opioid analgesic (CHEBI:35482) |
| tetrahydrofuranylfentanyl (CHEBI:183782) has role μ-opioid receptor agonist (CHEBI:55322) |
| tetrahydrofuranylfentanyl (CHEBI:183782) is a anilide (CHEBI:13248) |
| tetrahydrofuranylfentanyl (CHEBI:183782) is a monocarboxylic acid amide (CHEBI:29347) |
| tetrahydrofuranylfentanyl (CHEBI:183782) is a oxolanes (CHEBI:26912) |
| tetrahydrofuranylfentanyl (CHEBI:183782) is a piperidines (CHEBI:26151) |
| tetrahydrofuranylfentanyl (CHEBI:183782) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]tetrahydrofuran-2-carboxamide |
| Synonyms | Source |
|---|---|
| N-(1-phenethylpiperidin-4-yl)-N-phenyltetrahydrofuran-2-carboxamide | KEGG COMPOUND |
| N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]oxolane-2-carboxamide | IUPAC |
| tetrahydro-N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-2-furancarboxamide | ChEBI |
| tetrahydrofuran fentanyl | ChEBI |
| tetrahydrofuranyl fentanyl | ChEBI |
| THF-F | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 81367441 | ChemSpider |
| C22758 | KEGG COMPOUND |
| Tetrahydrofuranylfentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2142571-01-3 | KEGG COMPOUND |
| Citations |
|---|