EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO3 |
| Net Charge | 0 |
| Average Mass | 261.321 |
| Monoisotopic Mass | 261.13649 |
| SMILES | O=C(O)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H19NO3/c17-14(7-6-12-4-2-1-3-5-12)16-10-8-13(9-11-16)15(18)19/h1-5,13H,6-11H2,(H,18,19) |
| InChIKey | WQOSVYASWDJHLK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3-phenylpropanoyl)-4-piperidinecarboxylic acid (CHEBI:183768) is a carboxylic acid (CHEBI:33575) |
| 1-(3-phenylpropanoyl)-4-piperidinecarboxylic acid (CHEBI:183768) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 1-(3-phenylpropanoyl)piperidine-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2091596 | ChemSpider |