EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO2S |
| Net Charge | 0 |
| Average Mass | 223.297 |
| Monoisotopic Mass | 223.06670 |
| SMILES | Cc1ccc(NC2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H13NO2S/c1-9-2-4-10(5-3-9)12-11-6-7-15(13,14)8-11/h2-7,11-12H,8H2,1H3 |
| InChIKey | WFUOZPNGTQPNEE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-Methylphenyl)-2,3-dihydro-3-thiophenamine 1,1-dioxide (CHEBI:183752) is a aminotoluene (CHEBI:22531) |
| IUPAC Name |
|---|
| N-(4-methylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| Manual Xrefs | Databases |
|---|---|
| 2096671 | ChemSpider |