EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25FN4O2 |
| Net Charge | 0 |
| Average Mass | 348.422 |
| Monoisotopic Mass | 348.19615 |
| SMILES | CCCC(F)Cn1nc(C(=O)NC(C(N)=O)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C18H25FN4O2/c1-4-7-12(19)10-23-14-9-6-5-8-13(14)16(22-23)18(25)21-15(11(2)3)17(20)24/h5-6,8-9,11-12,15H,4,7,10H2,1-3H3,(H2,20,24)(H,21,25) |
| InChIKey | VKIBZLGSWZHFJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AB-PINACA N-(2-fluoropentyl) isomer (CHEBI:183745) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-(2-luoropentyl)indazole-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 30922482 | ChemSpider |