EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7N5 |
| Net Charge | 0 |
| Average Mass | 161.168 |
| Monoisotopic Mass | 161.07015 |
| SMILES | Cc1ncc2c(N)ncnc2n1 |
| InChI | InChI=1S/C7H7N5/c1-4-9-2-5-6(8)10-3-11-7(5)12-4/h2-3H,1H3,(H2,8,9,10,11,12) |
| InChIKey | RHUWDRAGKXQQDV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methylpyrimido[4,5-d]pyrimidin-4-amine (CHEBI:183744) is a aminopyrimidine (CHEBI:38338) |
| IUPAC Name |
|---|
| 2-methylpyrimido[4,5-d]pyrimidin-5-amine |
| Manual Xrefs | Databases |
|---|---|
| 2022198 | ChemSpider |