EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:183743 - 2-[(butylamino)(imino)methyl]-1-oxohydrazinium-1-olate
| Formula | C5H12N4O2 |
| Net Charge | 0 |
| Average Mass | 160.177 |
| Monoisotopic Mass | 160.09603 |
| SMILES | CCCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C5H12N4O2/c1-2-3-4-7-5(6)8-9(10)11/h2-4H2,1H3,(H3,6,7,8) |
| InChIKey | KPQHRDFCWBWTBA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(butylamino)(imino)methyl]-1-oxohydrazinium-1-olate (CHEBI:183743) is a nitroguanidine (CHEBI:39179) |
| IUPAC Name |
|---|
| 2-butyl-1-nitroguanidine |