EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18374 - 1-(5-phospho-β-D-ribosyl)-5'-AMP
| Formula | C15H23N5O14P2 |
| Net Charge | 0 |
| Average Mass | 559.318 |
| Monoisotopic Mass | 559.07167 |
| SMILES | N=c1c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c2ncn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23N5O14P2/c16-12-7-13(18-4-19(12)14-10(23)8(21)5(33-14)1-31-35(25,26)27)20(3-17-7)15-11(24)9(22)6(34-15)2-32-36(28,29)30/h3-6,8-11,14-16,21-24H,1-2H2,(H2,25,26,27)(H2,28,29,30)/t5-,6-,8-,9-,10-,11-,14-,15-/m1/s1 |
| InChIKey | RTQMRTSPTLIIHM-KEOHHSTQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(5-phospho-β-D-ribosyl)-5'-AMP (CHEBI:18374) has role Escherichia coli metabolite (CHEBI:76971) |
| 1-(5-phospho-β-D-ribosyl)-5'-AMP (CHEBI:18374) is a AMP-sugar (CHEBI:20853) |
| 1-(5-phospho-β-D-ribosyl)-5'-AMP (CHEBI:18374) is conjugate acid of 1-(5-phosphonato-β-D-ribosyl)-5'-AMP(4−) (CHEBI:59457) |
| Incoming Relation(s) |
| 1-(5-phosphonato-β-D-ribosyl)-5'-AMP(4−) (CHEBI:59457) is conjugate base of 1-(5-phospho-β-D-ribosyl)-5'-AMP (CHEBI:18374) |
| IUPAC Names |
|---|
| 1-(5-phospho-β-D-ribofuranosyl)-5'-adenylic acid |
| 1-(5-O-phosphono-β-D-ribofuranosyl)adenosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 1-(5-Phosphoribosyl)-AMP | KEGG COMPOUND |
| Phosphoribosyl-AMP | KEGG COMPOUND |
| 5-phosphoribosyl-AMP | ChEBI |
| N1-(5-Phospho-D-ribosyl)-AMP | KEGG COMPOUND |
| 1-(5-Phospho-beta-D-ribosyl)-AMP | KEGG COMPOUND |