EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18372 - 7,8-dihydroneopterin 3'-triphosphate
| Formula | C9H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 495.171 |
| Monoisotopic Mass | 494.99575 |
| SMILES | Nc1nc2c(c(=O)n1)N=C([C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CN2 |
| InChI | InChI=1S/C9H16N5O13P3/c10-9-13-7-5(8(17)14-9)12-3(1-11-7)6(16)4(15)2-25-29(21,22)27-30(23,24)26-28(18,19)20/h4,6,15-16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H4,10,11,13,14,17)/t4-,6+/m1/s1 |
| InChIKey | DGGUVLXVLHAAGT-XINAWCOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) has role Escherichia coli metabolite (CHEBI:76971) |
| 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) has role mouse metabolite (CHEBI:75771) |
| 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) is a dihydropterin (CHEBI:38797) |
| 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) is a neopterins (CHEBI:25500) |
| 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) is a pterin phosphate (CHEBI:36942) |
| 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) is conjugate acid of 7,8-dihydroneopterin 3'-triphosphate(4−) (CHEBI:58462) |
| Incoming Relation(s) |
| 7,8-dihydroneopterin 3'-triphosphate(4−) (CHEBI:58462) is conjugate base of 7,8-dihydroneopterin 3'-triphosphate (CHEBI:18372) |
| IUPAC Name |
|---|
| (2R,3S)-3-(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)-2,3-dihydroxypropyl tetrahydrogen triphosphate |
| Synonyms | Source |
|---|---|
| 2-Amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine triphosphate | KEGG COMPOUND |
| 6-(L-erythro-1,2-Dihydroxypropyl 3-triphosphate)-7,8-dihydropterin | KEGG COMPOUND |
| 6-[(1S,2R)-1,2-Dihydroxy-3-triphosphooxypropyl]-7,8-dihydropterin | KEGG COMPOUND |
| 7,8-dihydroneopterin 3'-triphosphate | IUBMB |
| 6-(L-erythro-1,2-dihydroxy-3-triphosphooxypropyl)-7,8-dihydropterin | ChEBI |
| 7,8-Dihydroneopterin 3'-triphosphate | KEGG COMPOUND |