EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO4 |
| Net Charge | 0 |
| Average Mass | 233.223 |
| Monoisotopic Mass | 233.06881 |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)O)cc1OC |
| InChI | InChI=1S/C12H11NO4/c1-16-10-4-3-8(6-11(10)17-2)5-9(7-13)12(14)15/h3-6H,1-2H3,(H,14,15)/b9-5+ |
| InChIKey | DMACYVMZKYRYSL-WEVVVXLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyano-3-(3,4-dimethoxyphenyl)acrylic acid (CHEBI:183702) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4525971 | ChemSpider |