EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12F3N3S |
| Net Charge | 0 |
| Average Mass | 275.299 |
| Monoisotopic Mass | 275.07040 |
| SMILES | NC(=S)c1ncc(C(F)(F)F)cc1N1CCCC1 |
| InChI | InChI=1S/C11H12F3N3S/c12-11(13,14)7-5-8(17-3-1-2-4-17)9(10(15)18)16-6-7/h5-6H,1-4H2,(H2,15,18) |
| InChIKey | PQEAKIQHXQYIFC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1-pyrrolidinyl)-5-(trifluoromethyl)pyridine-2-carbothioamide (CHEBI:183680) is a dialkylarylamine (CHEBI:23665) |
| 3-(1-pyrrolidinyl)-5-(trifluoromethyl)pyridine-2-carbothioamide (CHEBI:183680) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-pyrrolidin-1-yl-5-(triluoromethyl)pyridine-2-carbothioamide |
| Manual Xrefs | Databases |
|---|---|
| 2022062 | ChemSpider |