EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17NO4 |
| Net Charge | 0 |
| Average Mass | 359.381 |
| Monoisotopic Mass | 359.11576 |
| SMILES | O=C(Nc1ccccc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H17NO4/c24-21(25)18-11-5-6-12-20(18)23-22(26)27-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-12,19H,13H2,(H,23,26)(H,24,25) |
| InChIKey | CNAVPEPPAVHHKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(9H-9-fluorenylmethoxy)carbonyl]amino}benzoic acid (CHEBI:183678) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 2-(9H-luoren-9-ylmethoxycarbonylamino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 848108 | ChemSpider |