EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O2.C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 234.296 |
| Monoisotopic Mass | 234.15796 |
| SMILES | CCCC(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C4H8O2/c7-4-2-1-3-5(8)6(9)10;1-2-3-4(5)6/h5H,1-4,7-8H2,(H,9,10);2-3H2,1H3,(H,5,6)/t5-;/m0./s1 |
| InChIKey | RAQUISHGVNOAMH-JEDNCBNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lysine Butyrate (CHEBI:183668) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| butanoic acid;(2S)-2,6-diaminohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 117733 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:80407-71-2 | ChemIDplus |