EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9ClO4 |
| Net Charge | 0 |
| Average Mass | 216.620 |
| Monoisotopic Mass | 216.01894 |
| SMILES | COc1ccc(Cl)c(OC)c1C(=O)O |
| InChI | InChI=1S/C9H9ClO4/c1-13-6-4-3-5(10)8(14-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| InChIKey | CLZTVXIMOQUOEI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-2,6-dimethoxybenzoic acid (CHEBI:183662) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3-chloro-2,6-dimethoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 532163 | ChemSpider |