EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23FN3O3 |
| Net Charge | +1 |
| Average Mass | 396.442 |
| Monoisotopic Mass | 396.17180 |
| SMILES | O=C(c1ccc(F)cc1)C1CC[NH+](CCn2c(=O)nc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C22H22FN3O3/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29/h1-8,16H,9-14H2,(H,24,29)/p+1 |
| InChIKey | FPCCSQOGAWCVBH-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ketanserin(1+) (CHEBI:183638) is a piperidinium ion (CHEBI:48633) |
| ketanserin(1+) (CHEBI:183638) is conjugate acid of ketanserin (CHEBI:6123) |
| Incoming Relation(s) |
| ketanserin tartrate (CHEBI:183637) has part ketanserin(1+) (CHEBI:183638) |
| ketanserin (CHEBI:6123) is conjugate base of ketanserin(1+) (CHEBI:183638) |
| IUPAC Name |
|---|
| 1-[2-(2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl)ethyl]-4-(4-fluorobenzoyl)piperidinium |
| Synonym | Source |
|---|---|
| ketanserin cation | ChEBI |