EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25FN4O2S |
| Net Charge | 0 |
| Average Mass | 452.555 |
| Monoisotopic Mass | 452.16823 |
| SMILES | O=S1(=O)N(CCN2CC=C(c3cnc4cc(F)ccc34)CC2)c2cccc3c2N1CCC3 |
| InChI | InChI=1S/C24H25FN4O2S/c25-19-6-7-20-21(16-26-22(20)15-19)17-8-11-27(12-9-17)13-14-28-23-5-1-3-18-4-2-10-29(24(18)23)32(28,30)31/h1,3,5-8,15-16,26H,2,4,9-14H2 |
| InChIKey | BJIPVHLRWSDKOS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-367,265 (CHEBI:183634) has role antidepressant (CHEBI:35469) |
| LY-367,265 (CHEBI:183634) has role geroprotector (CHEBI:176497) |
| LY-367,265 (CHEBI:183634) has role serotonergic antagonist (CHEBI:48279) |
| LY-367,265 (CHEBI:183634) has role serotonin uptake inhibitor (CHEBI:50949) |
| LY-367,265 (CHEBI:183634) is a dihydropyridine (CHEBI:50075) |
| LY-367,265 (CHEBI:183634) is a fluoroindole (CHEBI:131960) |
| LY-367,265 (CHEBI:183634) is a tertiary amino compound (CHEBI:50996) |
| LY-367,265 (CHEBI:183634) is a thiadiazoloquinoline (CHEBI:183635) |
| IUPAC Name |
|---|
| 1-{2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydropyridin-1(2H)-yl]ethyl}-5,6-dihydro-1H,4H-[1,2,5]thiadiazolo[4,3,2-ij]quinoline 2,2-dioxide |
| Synonyms | Source |
|---|---|
| 1-{2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydropyridin-1(2H)-yl]ethyl}-5,6-dihydro-4H-2λ6-[1,2,5]thiadiazolo[4,3,2-ij]quinoline-2,2(1H)-dione | IUPAC |
| LY 367265 | ChemIDplus |
| LY-367265 | ChEBI |
| LY367265 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3797242 | ChemSpider |
| LY-367,265 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:210751-39-6 | ChemIDplus |
| Citations |
|---|