EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O3 |
| Net Charge | 0 |
| Average Mass | 292.419 |
| Monoisotopic Mass | 292.20384 |
| SMILES | C=CCCCC/C=C/C#CC(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h2,7-8,17,19H,1,3-6,9-10,12-13,15-16H2,(H,20,21)/b8-7+ |
| InChIKey | KICRKYKTMPUVKC-BQYQJAHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) | ||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-8-hydroxy-11E,17-octadecadien-9-ynoic acid (CHEBI:183626) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (11E)-8-hydroxyoctadeca-11,17-dien-9-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472259 | ChemSpider |
| LMFA01050282 | LIPID MAPS |