EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H42N4O6 |
| Net Charge | 0 |
| Average Mass | 614.743 |
| Monoisotopic Mass | 614.31044 |
| SMILES | C=CC1=C(C)C2=NC1CC1=NC(Cc3nc(c(CCC(=O)O)c3C)CC3N=C(C2)C(C)=C3CCC(=O)O)C(CCC(=O)O)=C1C |
| InChI | InChI=1S/C35H42N4O6/c1-6-21-17(2)25-13-26-18(3)23(8-11-34(42)43)31(37-26)16-32-24(9-12-35(44)45)20(5)28(39-32)15-30-22(7-10-33(40)41)19(4)27(38-30)14-29(21)36-25/h6,29-31,39H,1,7-16H2,2-5H3,(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | QTGZHJUSEYHULR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) | ||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Harderoporphyrinogen (CHEBI:183611) is a porphyrins (CHEBI:26214) |
| IUPAC Name |
|---|
| 3-[13,17-bis(2-carboxyethyl)-7-ethenyl-3,8,12,18-tetramethyl-1,5,6,10,14,15,20,24-octahydroporphyrin-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 168204 | ChemSpider |
| HMDB0002160 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:42607-18-1 | ChemIDplus |