EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O5 |
| Net Charge | 0 |
| Average Mass | 328.449 |
| Monoisotopic Mass | 328.22497 |
| SMILES | CC/C=C\C/C=C\[C@@H](O)[C@@H](O)[C@@H](O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O5/c1-2-3-4-6-9-12-15(19)18(23)16(20)13-10-7-5-8-11-14-17(21)22/h3-4,9,12,15-16,18-20,23H,2,5-8,10-11,13-14H2,1H3,(H,21,22)/b4-3-,12-9-/t15-,16+,18-/m1/s1 |
| InChIKey | KFINXCASWPGHEW-YQFBSDGMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) | ||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9S,10S,11R-trihydroxy-12Z,15Z-octadecadienoic acid (CHEBI:183609) is a octadecadienoic acid (CHEBI:25627) |
| IUPAC Name |
|---|
| (9S,10S,11R,12Z,15Z)-9,10,11-trihydroxyoctadeca-12,15-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17220738 | ChemSpider |
| LMFA02000021 | LIPID MAPS |