EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O2 |
| Net Charge | 0 |
| Average Mass | 156.225 |
| Monoisotopic Mass | 156.11503 |
| SMILES | CC/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h3-4H,2,5-8H2,1H3,(H,10,11)/b4-3+ |
| InChIKey | ZPSOISAMGWYNQX-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) | ||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6E-nonenoic acid (CHEBI:183587) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-non-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472014 | ChemSpider |
| LMFA01030446 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:31502-23-5 | ChemIDplus |