EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O7 |
| Net Charge | 0 |
| Average Mass | 512.643 |
| Monoisotopic Mass | 512.27740 |
| SMILES | CC1CC2(CC(C)C3C2C(=O)C2(C)C4=C(C(=O)C(O)C32C)C2(C)CCC(=O)C(C)(C)C2CC4O)OC1=O |
| InChI | InChI=1S/C30H40O7/c1-13-11-30(12-14(2)25(36)37-30)21-18(13)28(6)24(35)22(33)20-19(29(28,7)23(21)34)15(31)10-16-26(3,4)17(32)8-9-27(16,20)5/h13-16,18,21,24,31,35H,8-12H2,1-7H3 |
| InChIKey | BINIQAMAYCKIRZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) | ||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganosporelactone A (CHEBI:183586) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 10',20'-dihydroxy-2',3,7',9',13',17',17'-heptamethylspiro[oxolane-5,5'-pentacyclo[10.8.0.02,9.04,8.013,18]icos-1(12)-ene]-2,3',11',16'-tetrone |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036406 | HMDB |