EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H46O3 |
| Net Charge | 0 |
| Average Mass | 382.629 |
| Monoisotopic Mass | 382.34470 |
| SMILES | O=C(O)CCCCCCCC/C=C\CCCCCCCCCCCCCO |
| InChI | InChI=1S/C24H46O3/c25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24(26)27/h4,6,25H,1-3,5,7-23H2,(H,26,27)/b6-4- |
| InChIKey | VQZGIEKNJUIUHV-XQRVVYSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) | ||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-hydroxy-10Z-tetracosenoic acid (CHEBI:183577) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (Z)-24-hydroxytetracos-10-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472207 | ChemSpider |
| LMFA01050215 | LIPID MAPS |