EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\Cc1ccc(CC(=O)O)o1 |
| InChI | InChI=1S/C20H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-15-16-19(23-18)17-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | ASCYUTAWNJPWQT-LTKCOYKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) | ||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(5-((2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraen-1-yl)furan-2-yl)-ethanoic acid (CHEBI:183567) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-[5-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]uran-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 8533732 | ChemSpider |
| LMFA01150035 | LIPID MAPS |