EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O4 |
| Net Charge | 0 |
| Average Mass | 279.296 |
| Monoisotopic Mass | 279.12191 |
| SMILES | NC(=O)CC(N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17N3O4/c14-9(7-11(15)17)12(18)16-10(13(19)20)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,14H2,(H2,15,17)(H,16,18)(H,19,20) |
| InChIKey | OMSMPWHEGLNQOD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) | ||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asparaginyl-Phenylalanine (CHEBI:183548) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028738 | HMDB |
| 16568265 | ChemSpider |