EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]1([C@]2([H])O[C@@]2(C)C[C@@H](O)C=C(C)C)CCC2[C@@]3(C)CC[C@H](O)C(C)(C)C3CC[C@@]2(C)[C@@]12COC(=O)C2 |
| InChI | InChI=1S/C30H48O5/c1-18(2)14-19(31)15-29(7)25(35-29)20-8-9-22-27(5)12-11-23(32)26(3,4)21(27)10-13-28(22,6)30(20)16-24(33)34-17-30/h14,19-23,25,31-32H,8-13,15-17H2,1-7H3/t19-,20+,21?,22?,23-,25-,27-,28+,29-,30-/m0/s1 |
| InChIKey | NICHEDAQBKUSBN-XNHBMLHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) | ||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hovenolactone (CHEBI:183523) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,2S,4bR,7S,10aR)-7-hydroxy-2-[(2S,3S)-3-[(2R)-2-hydroxy-4-methylpent-3-enyl]-3-methyloxiran-2-yl]-4b,8,8,10a-tetramethylspiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,4'-oxolane]-2'-one |
| Manual Xrefs | Databases |
|---|---|
| 35014054 | ChemSpider |
| HMDB0035957 | HMDB |