EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO2 |
| Net Charge | 0 |
| Average Mass | 299.499 |
| Monoisotopic Mass | 299.28243 |
| SMILES | CCCCCCC(N)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h17H,2-16,19H2,1H3,(H,20,21) |
| InChIKey | YUQFYQHUZOPVPH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | |||
| primordium (BTO:0001886) | MetaboLights (MTBLS3577) | ||
| fruit body (BTO:0000487) | MetaboLights (MTBLS3577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-amino-octadecanoic acid (CHEBI:183518) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 12-aminooctadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472386 | ChemSpider |
| LMFA01100008 | LIPID MAPS |