EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8Br2N2O2 |
| Net Charge | 0 |
| Average Mass | 360.005 |
| Monoisotopic Mass | 357.89525 |
| SMILES | C/C(O)=C(\C#N)C(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H8Br2N2O2/c1-6(16)8(5-14)11(17)15-10-4-7(12)2-3-9(10)13/h2-4,16H,1H3,(H,15,17)/b8-6- |
| InChIKey | UVSVTDVJQAJIFG-VURMDHGXSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LFM-A13 (CHEBI:183517) has role antineoplastic agent (CHEBI:35610) |
| LFM-A13 (CHEBI:183517) has role apoptosis inducer (CHEBI:68495) |
| LFM-A13 (CHEBI:183517) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| LFM-A13 (CHEBI:183517) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| LFM-A13 (CHEBI:183517) has role geroprotector (CHEBI:176497) |
| LFM-A13 (CHEBI:183517) has role platelet aggregation inhibitor (CHEBI:50427) |
| LFM-A13 (CHEBI:183517) is a aromatic amide (CHEBI:62733) |
| LFM-A13 (CHEBI:183517) is a dibromobenzene (CHEBI:37147) |
| LFM-A13 (CHEBI:183517) is a enamide (CHEBI:51751) |
| LFM-A13 (CHEBI:183517) is a enol (CHEBI:33823) |
| LFM-A13 (CHEBI:183517) is a nitrile (CHEBI:18379) |
| LFM-A13 (CHEBI:183517) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2Z)-2-cyano-N-(2,5-dibromophenyl)-3-hydroxybut-2-enamide |
| Synonyms | Source |
|---|---|
| (2Z)-2-cyano-N-(2,5-dibromophenyl)-3-hydroxy-2-butenamide | ChEBI |
| 2Z-cyano-N-(2,5-dibromophenyl)-3-hydroxy-2-butenamide | ChEBI |
| DDE-28 | ChEBI |
| α-cyano-β-hydroxy-β-methyl-N-(2,5-dibromophenyl)propenamide | ChEBI |
| Citations |
|---|