EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O4 |
| Net Charge | 0 |
| Average Mass | 422.565 |
| Monoisotopic Mass | 422.24571 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C27H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(28)30-24-20-18-23-19-21-27(29)31-25(23)22-24/h6-7,9-10,12-13,18-22H,2-5,8,11,14-17H2,1H3/b7-6-,10-9-,13-12- |
| InChIKey | LPIXSKJJCANUQD-QNEBEIHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxycoumarinyl-gamma-linolenate (CHEBI:183481) is a coumarins (CHEBI:23403) |
| 7-hydroxycoumarinyl-gamma-linolenate (CHEBI:183481) is a octadecanoid (CHEBI:36326) |
| IUPAC Name |
|---|
| (2-oxochromen-7-yl) (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| Manual Xrefs | Databases |
|---|---|
| 29341782 | ChemSpider |