EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O |
| Net Charge | 0 |
| Average Mass | 294.398 |
| Monoisotopic Mass | 294.17321 |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2 |
| InChIKey | KMPWYEUPVWOPIM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-quinolyl(5-vinyl-1-azabicyclo[2.2.2]oct-2-yl)methanol (CHEBI:183479) is a cinchona alkaloid (CHEBI:51323) |
| IUPAC Name |
|---|
| (5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethanol |
| Manual Xrefs | Databases |
|---|---|
| 2655 | ChemSpider |
| HMDB0030282 | HMDB |