EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O5 |
| Net Charge | 0 |
| Average Mass | 328.364 |
| Monoisotopic Mass | 328.13107 |
| SMILES | O=C(/C=C/CCc1ccc(O)c(O)c1)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H20O5/c20-15(8-5-14-7-10-17(22)19(24)12-14)4-2-1-3-13-6-9-16(21)18(23)11-13/h2,4,6-7,9-12,21-24H,1,3,5,8H2/b4-2+ |
| InChIKey | VWHYFMQKJYFLCC-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4E)-1,7-bis(3,4-dihydroxyphenyl)hept-4-en-3-one (CHEBI:183478) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (E)-1,7-bis(3,4-dihydroxyphenyl)hept-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 553011 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:41137-87-5 | ChemIDplus |