EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O5 |
| Net Charge | 0 |
| Average Mass | 244.287 |
| Monoisotopic Mass | 244.13107 |
| SMILES | O=C(O)CCCCCCCC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H20O5/c13-10(8-9-12(16)17)6-4-2-1-3-5-7-11(14)15/h1-9H2,(H,14,15)(H,16,17) |
| InChIKey | HHXMOTDTSDYYEI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxododecanedioic acid (CHEBI:183468) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 4-oxododecanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 28424511 | ChemSpider |