EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO5 |
| Net Charge | 0 |
| Average Mass | 291.303 |
| Monoisotopic Mass | 291.11067 |
| SMILES | CC(O)/C=C/C1OC(=O)CC1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H17NO5/c1-9(17)2-7-13-12(8-14(18)21-13)16-11-5-3-10(4-6-11)15(19)20/h2-7,9,12-13,16-17H,8H2,1H3,(H,19,20)/b7-2+ |
| InChIKey | IZSWILLJDXDGDJ-FARCUNLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Obscurolide A1 (CHEBI:183467) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 4-[[2-[(E)-3-hydroxybut-1-enyl]-5-oxooxolan-3-yl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4943221 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:144397-99-9 | ChemIDplus |