EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25FN4O3 |
| Net Charge | 0 |
| Average Mass | 364.421 |
| Monoisotopic Mass | 364.19107 |
| SMILES | CC(C)C(NC(=O)c1nn(CCCC(O)CF)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C18H25FN4O3/c1-11(2)15(17(20)25)21-18(26)16-13-7-3-4-8-14(13)23(22-16)9-5-6-12(24)10-19/h3-4,7-8,11-12,15,24H,5-6,9-10H2,1-2H3,(H2,20,25)(H,21,26) |
| InChIKey | IEYDKWLGOBQFKU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluoro AB-PINACA N-(4-hydroxypentyl) metabolite (CHEBI:183465) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-(5-luoro-4-hydroxypentyl)indazole-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 29763743 | ChemSpider |